C8H10F3N — CID 88558934
(2Z,4Z)-1,1,1-trifluoro-5-methylhepta-2,4,6-trien-2-amine (PubChem CID 88558934) has the molecular formula C8H10F3N and a molecular weight of 177.17 g/mol. Its IUPAC name is (2Z,4Z)-1,1,1-trifluoro-5-methylhepta-2,4,6-trien-2-amine.
| Compound Name | (2Z,4Z)-1,1,1-trifluoro-5-methylhepta-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 88558934 |
| Molecular Formula | C8H10F3N |
| Molecular Weight | 177.17 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | (2Z,4Z)-1,1,1-trifluoro-5-methylhepta-2,4,6-trien-2-amine |
| SMILES | C=C/C(C)=C\C=C(/N)C(F)(F)F |
| InChI | InChI=1S/C8H10F3N/c1-3-6(2)4-5-7(12)8(9,10)11/h3-5H,1,12H2,2H3/b6-4-,7-5- |
| InChIKey | TUAOICUBKWACLB-PEPZGXQESA-N |
| XLogP | 2.52 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.17 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|