C10H12F3NO — CID 129120316
(3Z,5E)-8,8,8-trifluoro-3,6-dimethyl-7-nitrosoocta-1,3,5-triene (PubChem CID 129120316) has the molecular formula C10H12F3NO and a molecular weight of 219.21 g/mol. Its IUPAC name is (3Z,5E)-8,8,8-trifluoro-3,6-dimethyl-7-nitrosoocta-1,3,5-triene.
| Compound Name | (3Z,5E)-8,8,8-trifluoro-3,6-dimethyl-7-nitrosoocta-1,3,5-triene |
|---|---|
| PubChem CID | 129120316 |
| Molecular Formula | C10H12F3NO |
| Molecular Weight | 219.21 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | (3Z,5E)-8,8,8-trifluoro-3,6-dimethyl-7-nitrosoocta-1,3,5-triene |
| SMILES | C=C/C(C)=C\C=C(/C)C(N=O)C(F)(F)F |
| InChI | InChI=1S/C10H12F3NO/c1-4-7(2)5-6-8(3)9(14-15)10(11,12)13/h4-6,9H,1H2,2-3H3/b7-5-,8-6+ |
| InChIKey | CPYWPDFAEBDMPY-CGXWXWIYSA-N |
| XLogP | 3.76 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.21 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|