C13H21F — CID 167003915
(3Z,5E)-9-fluoro-3,6,9-trimethyldeca-1,3,5-triene (PubChem CID 167003915) has the molecular formula C13H21F and a molecular weight of 196.31 g/mol. Its IUPAC name is (3Z,5E)-9-fluoro-3,6,9-trimethyldeca-1,3,5-triene.
| Compound Name | (3Z,5E)-9-fluoro-3,6,9-trimethyldeca-1,3,5-triene |
|---|---|
| PubChem CID | 167003915 |
| Molecular Formula | C13H21F |
| Molecular Weight | 196.31 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | (3Z,5E)-9-fluoro-3,6,9-trimethyldeca-1,3,5-triene |
| SMILES | C=C/C(C)=C\C=C(/C)CCC(C)(C)F |
| InChI | InChI=1S/C13H21F/c1-6-11(2)7-8-12(3)9-10-13(4,5)14/h6-8H,1,9-10H2,2-5H3/b11-7-,12-8+ |
| InChIKey | UGODSKZIHORGPT-NTLHZVPKSA-N |
| XLogP | 4.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.31 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|