C14H21F3 — CID 145071766
ethane;(3E,5E)-4-ethyl-6-methyl-3-(trifluoromethyl)octa-1,3,5,7-tetraene (PubChem CID 145071766) has the molecular formula C14H21F3 and a molecular weight of 246.32 g/mol. Its IUPAC name is ethane;(3E,5E)-4-ethyl-6-methyl-3-(trifluoromethyl)octa-1,3,5,7-tetraene.
| Compound Name | ethane;(3E,5E)-4-ethyl-6-methyl-3-(trifluoromethyl)octa-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 145071766 |
| Molecular Formula | C14H21F3 |
| Molecular Weight | 246.32 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | ethane;(3E,5E)-4-ethyl-6-methyl-3-(trifluoromethyl)octa-1,3,5,7-tetraene |
| SMILES | C=C/C(C)=C/C(CC)=C(\C=C)C(F)(F)F.CC |
| InChI | InChI=1S/C12H15F3.C2H6/c1-5-9(4)8-10(6-2)11(7-3)12(13,14)15;1-2/h5,7-8H,1,3,6H2,2,4H3;1-2H3/b9-8+,11-10+; |
| InChIKey | KZCGSEFKVHTLPE-YIUKEKEQSA-N |
| XLogP | 5.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.32 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|