C10H19F3O — CID 145372548
ethane;(2Z)-3-(trifluoromethyl)penta-2,4-dien-2-ol (PubChem CID 145372548) has the molecular formula C10H19F3O and a molecular weight of 212.25 g/mol. Its IUPAC name is ethane;(2Z)-3-(trifluoromethyl)penta-2,4-dien-2-ol.
| Compound Name | ethane;(2Z)-3-(trifluoromethyl)penta-2,4-dien-2-ol |
|---|---|
| PubChem CID | 145372548 |
| Molecular Formula | C10H19F3O |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.14 |
| IUPAC Name | ethane;(2Z)-3-(trifluoromethyl)penta-2,4-dien-2-ol |
| SMILES | C=C/C(=C(\C)O)C(F)(F)F.CC.CC |
| InChI | InChI=1S/C6H7F3O.2C2H6/c1-3-5(4(2)10)6(7,8)9;2*1-2/h3,10H,1H2,2H3;2*1-2H3/b5-4-;; |
| InChIKey | WVUBBCMERZCBKP-WNCVTPEDSA-N |
| XLogP | 4.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|