C10H21NO — CID 143976518
ethane;(3E)-4-(methylideneamino)penta-1,3-dien-3-ol (PubChem CID 143976518) has the molecular formula C10H21NO and a molecular weight of 171.28 g/mol. Its IUPAC name is ethane;(3E)-4-(methylideneamino)penta-1,3-dien-3-ol.
| Compound Name | ethane;(3E)-4-(methylideneamino)penta-1,3-dien-3-ol |
|---|---|
| PubChem CID | 143976518 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | ethane;(3E)-4-(methylideneamino)penta-1,3-dien-3-ol |
| SMILES | C=C/C(O)=C(/C)N=C.CC.CC |
| InChI | InChI=1S/C6H9NO.2C2H6/c1-4-6(8)5(2)7-3;2*1-2/h4,8H,1,3H2,2H3;2*1-2H3/b6-5+;; |
| InChIKey | RUEQQVQXMADUAQ-TXOOBNKBSA-N |
| XLogP | 3.71 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|