C8H13Br2N — CID 163370351
N-[(2E)-1,3-dibromopenta-2,4-dien-2-yl]methanimine;ethane (PubChem CID 163370351) has the molecular formula C8H13Br2N and a molecular weight of 283.01 g/mol. Its IUPAC name is N-[(2E)-1,3-dibromopenta-2,4-dien-2-yl]methanimine;ethane.
| Compound Name | N-[(2E)-1,3-dibromopenta-2,4-dien-2-yl]methanimine;ethane |
|---|---|
| PubChem CID | 163370351 |
| Molecular Formula | C8H13Br2N |
| Molecular Weight | 283.01 g/mol |
| Exact Mass | 280.94 |
| IUPAC Name | N-[(2E)-1,3-dibromopenta-2,4-dien-2-yl]methanimine;ethane |
| SMILES | C=C/C(Br)=C(/CBr)N=C.CC |
| InChI | InChI=1S/C6H7Br2N.C2H6/c1-3-5(8)6(4-7)9-2;1-2/h3H,1-2,4H2;1-2H3/b6-5+; |
| InChIKey | RUCJBFSJTJVQHL-IPZCTEOASA-N |
| XLogP | 3.90 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.01 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|