About N-[(3Z)-4-propylsulfanylhexa-1,3,5-trien-3-yl]methanimine
N-[(3Z)-4-propylsulfanylhexa-1,3,5-trien-3-yl]methanimine (PubChem CID 143106690) has the molecular formula C10H15NS
and a molecular weight of 181.30 g/mol. Its IUPAC name is N-[(3Z)-4-propylsulfanylhexa-1,3,5-trien-3-yl]methanimine.
Molecular Properties
| Compound Name | N-[(3Z)-4-propylsulfanylhexa-1,3,5-trien-3-yl]methanimine |
| PubChem CID | 143106690 |
| Molecular Formula | C10H15NS |
| Molecular Weight | 181.30 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | N-[(3Z)-4-propylsulfanylhexa-1,3,5-trien-3-yl]methanimine |
| SMILES | C=C/C(N=C)=C(\C=C)SCCC |
| InChI | InChI=1S/C10H15NS/c1-5-8-12-10(7-3)9(6-2)11-4/h6-7H,2-5,8H2,1H3/b10-9- |
| InChIKey | OMMGQDMOSNYCHR-KTKRTIGZSA-N |
| XLogP | 3.41 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(3Z)-4-propylsulfanylhexa-1,3,5-trien-3-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3Z)-4-propylsulfanylhexa-1,3,5-trien-3-yl]methanimine?
The IUPAC name of N-[(3Z)-4-propylsulfanylhexa-1,3,5-trien-3-yl]methanimine (CID 143106690) is N-[(3Z)-4-propylsulfanylhexa-1,3,5-trien-3-yl]methanimine.
What is the SMILES notation for N-[(3Z)-4-propylsulfanylhexa-1,3,5-trien-3-yl]methanimine?
The canonical SMILES for N-[(3Z)-4-propylsulfanylhexa-1,3,5-trien-3-yl]methanimine is C=C/C(N=C)=C(\C=C)SCCC.
What is the InChIKey of N-[(3Z)-4-propylsulfanylhexa-1,3,5-trien-3-yl]methanimine?
The InChIKey is OMMGQDMOSNYCHR-KTKRTIGZSA-N. The full InChI is InChI=1S/C10H15NS/c1-5-8-12-10(7-3)9(6-2)11-4/h6-7H,2-5,8H2,1H3/b10-9-.
What are the key properties of N-[(3Z)-4-propylsulfanylhexa-1,3,5-trien-3-yl]methanimine?
N-[(3Z)-4-propylsulfanylhexa-1,3,5-trien-3-yl]methanimine has a molecular weight of 181.30 g/mol, XLogP of 3.41, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3Z)-4-propylsulfanylhexa-1,3,5-trien-3-yl]methanimine is sourced from PubChem (CID 143106690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).