C9H15NS — CID 126493047
N-[(2E,4E)-4-ethylsulfanylhexa-2,4-dien-3-yl]methanimine (PubChem CID 126493047) has the molecular formula C9H15NS and a molecular weight of 169.29 g/mol. Its IUPAC name is N-[(2E,4E)-4-ethylsulfanylhexa-2,4-dien-3-yl]methanimine.
| Compound Name | N-[(2E,4E)-4-ethylsulfanylhexa-2,4-dien-3-yl]methanimine |
|---|---|
| PubChem CID | 126493047 |
| Molecular Formula | C9H15NS |
| Molecular Weight | 169.29 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | N-[(2E,4E)-4-ethylsulfanylhexa-2,4-dien-3-yl]methanimine |
| SMILES | C=NC(=C/C)/C(=C\C)SCC |
| InChI | InChI=1S/C9H15NS/c1-5-8(10-4)9(6-2)11-7-3/h5-6H,4,7H2,1-3H3/b8-5+,9-6+ |
| InChIKey | DCHPOHIXHDFRJS-XVYDYJIPSA-N |
| XLogP | 3.25 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.29 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|