C7H9NS — CID 90767189
4,5-di(ethylidene)-1,3-thiazole (PubChem CID 90767189) has the molecular formula C7H9NS and a molecular weight of 139.22 g/mol. Its IUPAC name is 4,5-di(ethylidene)-1,3-thiazole.
| Compound Name | 4,5-di(ethylidene)-1,3-thiazole |
|---|---|
| PubChem CID | 90767189 |
| Molecular Formula | C7H9NS |
| Molecular Weight | 139.22 g/mol |
| Exact Mass | 139.05 |
| IUPAC Name | 4,5-di(ethylidene)-1,3-thiazole |
| SMILES | CC=c1ncsc1=CC |
| InChI | InChI=1S/C7H9NS/c1-3-6-7(4-2)9-5-8-6/h3-5H,1-2H3 |
| InChIKey | WUMKBIZHWFFPAY-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.22 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |