C7H8N2S — CID 91101949
N-methyl-4-prop-2-enylidene-1,3-thiazol-5-imine (PubChem CID 91101949) has the molecular formula C7H8N2S and a molecular weight of 152.22 g/mol. Its IUPAC name is N-methyl-4-prop-2-enylidene-1,3-thiazol-5-imine.
| Compound Name | N-methyl-4-prop-2-enylidene-1,3-thiazol-5-imine |
|---|---|
| PubChem CID | 91101949 |
| Molecular Formula | C7H8N2S |
| Molecular Weight | 152.22 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | N-methyl-4-prop-2-enylidene-1,3-thiazol-5-imine |
| SMILES | C=CC=C1N=CS/C1=N\C |
| InChI | InChI=1S/C7H8N2S/c1-3-4-6-7(8-2)10-5-9-6/h3-5H,1H2,2H3/b6-4?,8-7- |
| InChIKey | XBQCGDROVWUSGJ-BSHKIBQKSA-N |
| XLogP | 1.86 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|