C8H10N2S — CID 90764624
4-but-2-enylidene-N-methyl-1,3-thiazol-5-imine (PubChem CID 90764624) has the molecular formula C8H10N2S and a molecular weight of 166.25 g/mol. Its IUPAC name is 4-but-2-enylidene-N-methyl-1,3-thiazol-5-imine.
| Compound Name | 4-but-2-enylidene-N-methyl-1,3-thiazol-5-imine |
|---|---|
| PubChem CID | 90764624 |
| Molecular Formula | C8H10N2S |
| Molecular Weight | 166.25 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 4-but-2-enylidene-N-methyl-1,3-thiazol-5-imine |
| SMILES | CC=CC=C1N=CS/C1=N\C |
| InChI | InChI=1S/C8H10N2S/c1-3-4-5-7-8(9-2)11-6-10-7/h3-6H,1-2H3/b4-3?,7-5?,9-8- |
| InChIKey | OWPFXAXHJARDQF-BUZPJLGZSA-N |
| XLogP | 2.25 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.25 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|