C10H14N2S — CID 91295431
N-butyl-4-prop-2-enylidene-1,3-thiazol-5-imine (PubChem CID 91295431) has the molecular formula C10H14N2S and a molecular weight of 194.30 g/mol. Its IUPAC name is N-butyl-4-prop-2-enylidene-1,3-thiazol-5-imine.
| Compound Name | N-butyl-4-prop-2-enylidene-1,3-thiazol-5-imine |
|---|---|
| PubChem CID | 91295431 |
| Molecular Formula | C10H14N2S |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | N-butyl-4-prop-2-enylidene-1,3-thiazol-5-imine |
| SMILES | C=CC=C1N=CS/C1=N\CCCC |
| InChI | InChI=1S/C10H14N2S/c1-3-5-7-11-10-9(6-4-2)12-8-13-10/h4,6,8H,2-3,5,7H2,1H3/b9-6?,11-10- |
| InChIKey | YJOMKLQSDSFIGX-BHDYDZNQSA-N |
| XLogP | 3.03 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|