C7H8ClNS — CID 123872211
2-chloro-4,5-di(ethylidene)-1,3-thiazole (PubChem CID 123872211) has the molecular formula C7H8ClNS and a molecular weight of 173.67 g/mol. Its IUPAC name is 2-chloro-4,5-di(ethylidene)-1,3-thiazole.
| Compound Name | 2-chloro-4,5-di(ethylidene)-1,3-thiazole |
|---|---|
| PubChem CID | 123872211 |
| Molecular Formula | C7H8ClNS |
| Molecular Weight | 173.67 g/mol |
| Exact Mass | 173.01 |
| IUPAC Name | 2-chloro-4,5-di(ethylidene)-1,3-thiazole |
| SMILES | CC=c1nc(Cl)sc1=CC |
| InChI | InChI=1S/C7H8ClNS/c1-3-5-6(4-2)10-7(8)9-5/h3-4H,1-2H3 |
| InChIKey | JYRKHZRACLDLFH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.67 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |