C6H9FN2 — CID 142099703
(2E)-3-fluoro-2-(methylideneamino)penta-2,4-dien-1-amine (PubChem CID 142099703) has the molecular formula C6H9FN2 and a molecular weight of 128.15 g/mol. Its IUPAC name is (2E)-3-fluoro-2-(methylideneamino)penta-2,4-dien-1-amine.
| Compound Name | (2E)-3-fluoro-2-(methylideneamino)penta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 142099703 |
| Molecular Formula | C6H9FN2 |
| Molecular Weight | 128.15 g/mol |
| Exact Mass | 128.07 |
| IUPAC Name | (2E)-3-fluoro-2-(methylideneamino)penta-2,4-dien-1-amine |
| SMILES | C=C/C(F)=C(/CN)N=C |
| InChI | InChI=1S/C6H9FN2/c1-3-5(7)6(4-8)9-2/h3H,1-2,4,8H2/b6-5+ |
| InChIKey | QQSDFNSCOYUSBW-AATRIKPKSA-N |
| XLogP | 1.01 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.15 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|