C6H8FP — CID 155693231
[(3Z)-4-fluorohexa-1,3,5-trien-3-yl]phosphane (PubChem CID 155693231) has the molecular formula C6H8FP and a molecular weight of 130.10 g/mol. Its IUPAC name is [(3Z)-4-fluorohexa-1,3,5-trien-3-yl]phosphane.
| Compound Name | [(3Z)-4-fluorohexa-1,3,5-trien-3-yl]phosphane |
|---|---|
| PubChem CID | 155693231 |
| Molecular Formula | C6H8FP |
| Molecular Weight | 130.10 g/mol |
| Exact Mass | 130.03 |
| IUPAC Name | [(3Z)-4-fluorohexa-1,3,5-trien-3-yl]phosphane |
| SMILES | C=C/C(F)=C(/P)C=C |
| InChI | InChI=1S/C6H8FP/c1-3-5(7)6(8)4-2/h3-4H,1-2,8H2/b6-5- |
| InChIKey | QPZCKEINTIDFPJ-WAYWQWQTSA-N |
| XLogP | 2.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.10 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|