C9H12BrF — CID 123787783
4-bromo-3-fluoro-7-methylocta-1,3,5-triene (PubChem CID 123787783) has the molecular formula C9H12BrF and a molecular weight of 219.10 g/mol. Its IUPAC name is 4-bromo-3-fluoro-7-methylocta-1,3,5-triene.
| Compound Name | 4-bromo-3-fluoro-7-methylocta-1,3,5-triene |
|---|---|
| PubChem CID | 123787783 |
| Molecular Formula | C9H12BrF |
| Molecular Weight | 219.10 g/mol |
| Exact Mass | 218.01 |
| IUPAC Name | 4-bromo-3-fluoro-7-methylocta-1,3,5-triene |
| SMILES | C=CC(F)=C(Br)C=CC(C)C |
| InChI | InChI=1S/C9H12BrF/c1-4-9(11)8(10)6-5-7(2)3/h4-7H,1H2,2-3H3 |
| InChIKey | IJVOHOCAWZHGFZ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.10 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|