C19H30 — CID 142216572
(4Z,7Z,8Z)-5-ethenyl-2,10-dimethyl-7-(2-methylpropylidene)undeca-2,4,8-triene (PubChem CID 142216572) has the molecular formula C19H30 and a molecular weight of 258.45 g/mol. Its IUPAC name is (4Z,7Z,8Z)-5-ethenyl-2,10-dimethyl-7-(2-methylpropylidene)undeca-2,4,8-triene.
| Compound Name | (4Z,7Z,8Z)-5-ethenyl-2,10-dimethyl-7-(2-methylpropylidene)undeca-2,4,8-triene |
|---|---|
| PubChem CID | 142216572 |
| Molecular Formula | C19H30 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | (4Z,7Z,8Z)-5-ethenyl-2,10-dimethyl-7-(2-methylpropylidene)undeca-2,4,8-triene |
| SMILES | C=C/C(=C\C=C(C)C)CC(/C=C\C(C)C)=C/C(C)C |
| InChI | InChI=1S/C19H30/c1-8-18(11-9-15(2)3)14-19(13-17(6)7)12-10-16(4)5/h8-13,16-17H,1,14H2,2-7H3/b12-10-,18-11+,19-13+ |
| InChIKey | PWYZTZJBCICKJB-UPHIPDQKSA-N |
| XLogP | 6.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|