C12H18F3NO — CID 162564197
(2E)-2-ethenyl-5-methyl-N-(2,2,2-trifluoro-1-methoxyethyl)hexa-2,4-dien-1-amine (PubChem CID 162564197) has the molecular formula C12H18F3NO and a molecular weight of 249.28 g/mol. Its IUPAC name is (2E)-2-ethenyl-5-methyl-N-(2,2,2-trifluoro-1-methoxyethyl)hexa-2,4-dien-1-amine.
| Compound Name | (2E)-2-ethenyl-5-methyl-N-(2,2,2-trifluoro-1-methoxyethyl)hexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 162564197 |
| Molecular Formula | C12H18F3NO |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | (2E)-2-ethenyl-5-methyl-N-(2,2,2-trifluoro-1-methoxyethyl)hexa-2,4-dien-1-amine |
| SMILES | C=C/C(=C\C=C(C)C)CNC(OC)C(F)(F)F |
| InChI | InChI=1S/C12H18F3NO/c1-5-10(7-6-9(2)3)8-16-11(17-4)12(13,14)15/h5-7,11,16H,1,8H2,2-4H3/b10-7+ |
| InChIKey | STULFUUQOPBBGJ-JXMROGBWSA-N |
| XLogP | 3.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|