C17H25N — CID 142101563
(2E,4E,6E,7Z)-5-ethenyl-N,9-dimethyl-6-prop-2-enylidenedeca-2,4,7-trien-2-amine (PubChem CID 142101563) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is (2E,4E,6E,7Z)-5-ethenyl-N,9-dimethyl-6-prop-2-enylidenedeca-2,4,7-trien-2-amine.
| Compound Name | (2E,4E,6E,7Z)-5-ethenyl-N,9-dimethyl-6-prop-2-enylidenedeca-2,4,7-trien-2-amine |
|---|---|
| PubChem CID | 142101563 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | (2E,4E,6E,7Z)-5-ethenyl-N,9-dimethyl-6-prop-2-enylidenedeca-2,4,7-trien-2-amine |
| SMILES | C=C/C=C(\C=C/C(C)C)C(C=C)=C/C=C(\C)NC |
| InChI | InChI=1S/C17H25N/c1-7-9-17(12-10-14(3)4)16(8-2)13-11-15(5)18-6/h7-14,18H,1-2H2,3-6H3/b12-10-,15-11+,16-13+,17-9+ |
| InChIKey | UXOISTTWRWEBSN-NSPBRJMTSA-N |
| XLogP | 4.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|