C15H18O2 — CID 130246527
(2E,4E,6E,8E)-5,6-bis(ethenyl)undeca-2,4,6,8,10-pentaene-2,9-diol (PubChem CID 130246527) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is (2E,4E,6E,8E)-5,6-bis(ethenyl)undeca-2,4,6,8,10-pentaene-2,9-diol.
| Compound Name | (2E,4E,6E,8E)-5,6-bis(ethenyl)undeca-2,4,6,8,10-pentaene-2,9-diol |
|---|---|
| PubChem CID | 130246527 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (2E,4E,6E,8E)-5,6-bis(ethenyl)undeca-2,4,6,8,10-pentaene-2,9-diol |
| SMILES | C=C/C(O)=C\C=C(C=C)\C(C=C)=C\C=C(/C)O |
| InChI | InChI=1S/C15H18O2/c1-5-13(9-8-12(4)16)14(6-2)10-11-15(17)7-3/h5-11,16-17H,1-3H2,4H3/b12-8+,13-9+,14-10+,15-11+ |
| InChIKey | SVHSKAIMFMRWQY-IBLHVVBDSA-N |
| XLogP | 4.30 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|