C7H12O — CID 173388590
5-methylhexa-2,4-dien-2-ol (PubChem CID 173388590) has the molecular formula C7H12O and a molecular weight of 112.17 g/mol. Its IUPAC name is 5-methylhexa-2,4-dien-2-ol.
| Compound Name | 5-methylhexa-2,4-dien-2-ol |
|---|---|
| PubChem CID | 173388590 |
| Molecular Formula | C7H12O |
| Molecular Weight | 112.17 g/mol |
| Exact Mass | 112.09 |
| IUPAC Name | 5-methylhexa-2,4-dien-2-ol |
| SMILES | CC(C)=CC=C(C)O |
| InChI | InChI=1S/C7H12O/c1-6(2)4-5-7(3)8/h4-5,8H,1-3H3 |
| InChIKey | WZOVYASMDWPROS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.17 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|