C5H8O3 — CID 167098733
(3E)-penta-1,3-diene-1,1,4-triol (PubChem CID 167098733) has the molecular formula C5H8O3 and a molecular weight of 116.12 g/mol. Its IUPAC name is (3E)-penta-1,3-diene-1,1,4-triol.
| Compound Name | (3E)-penta-1,3-diene-1,1,4-triol |
|---|---|
| PubChem CID | 167098733 |
| Molecular Formula | C5H8O3 |
| Molecular Weight | 116.12 g/mol |
| Exact Mass | 116.05 |
| IUPAC Name | (3E)-penta-1,3-diene-1,1,4-triol |
| SMILES | C/C(O)=C\C=C(O)O |
| InChI | InChI=1S/C5H8O3/c1-4(6)2-3-5(7)8/h2-3,6-8H,1H3/b4-2+ |
| InChIKey | NZDRRSURHRSQMD-DUXPYHPUSA-N |
| XLogP | 1.41 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.12 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|