C7H10O3 — CID 89317612
(3E,5E)-hepta-1,3,5-triene-2,3,6-triol (PubChem CID 89317612) has the molecular formula C7H10O3 and a molecular weight of 142.15 g/mol. Its IUPAC name is (3E,5E)-hepta-1,3,5-triene-2,3,6-triol.
| Compound Name | (3E,5E)-hepta-1,3,5-triene-2,3,6-triol |
|---|---|
| PubChem CID | 89317612 |
| Molecular Formula | C7H10O3 |
| Molecular Weight | 142.15 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | (3E,5E)-hepta-1,3,5-triene-2,3,6-triol |
| SMILES | C=C(O)/C(O)=C\C=C(/C)O |
| InChI | InChI=1S/C7H10O3/c1-5(8)3-4-7(10)6(2)9/h3-4,8-10H,2H2,1H3/b5-3+,7-4+ |
| InChIKey | UXXQQGZXGSPGQE-HJIKTHEYSA-N |
| XLogP | 1.96 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.15 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|