C8H12O2 — CID 88665396
(2Z,4E,6Z)-octa-2,4,6-triene-2,6-diol (PubChem CID 88665396) has the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. Its IUPAC name is (2Z,4E,6Z)-octa-2,4,6-triene-2,6-diol.
| Compound Name | (2Z,4E,6Z)-octa-2,4,6-triene-2,6-diol |
|---|---|
| PubChem CID | 88665396 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | (2Z,4E,6Z)-octa-2,4,6-triene-2,6-diol |
| SMILES | C/C=C(O)/C=C/C=C(/C)O |
| InChI | InChI=1S/C8H12O2/c1-3-8(10)6-4-5-7(2)9/h3-6,9-10H,1-2H3/b6-4+,7-5-,8-3- |
| InChIKey | QTLGLMOKXYEJHP-IGVDJYRLSA-N |
| XLogP | 2.47 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|