C8H14O — CID 144538239
(2E,4Z)-octa-2,4-dien-3-ol (PubChem CID 144538239) has the molecular formula C8H14O and a molecular weight of 126.20 g/mol. Its IUPAC name is (2E,4Z)-octa-2,4-dien-3-ol.
| Compound Name | (2E,4Z)-octa-2,4-dien-3-ol |
|---|---|
| PubChem CID | 144538239 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | (2E,4Z)-octa-2,4-dien-3-ol |
| SMILES | C/C=C(O)\C=C/CCC |
| InChI | InChI=1S/C8H14O/c1-3-5-6-7-8(9)4-2/h4,6-7,9H,3,5H2,1-2H3/b7-6-,8-4+ |
| InChIKey | PZIYRDAWPYBMKB-AKAREZBESA-N |
| XLogP | 2.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|