C17H26O2 — CID 171853113
heptadeca-2,4,11,13,15-pentaene-3,13-diol (PubChem CID 171853113) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is heptadeca-2,4,11,13,15-pentaene-3,13-diol.
| Compound Name | heptadeca-2,4,11,13,15-pentaene-3,13-diol |
|---|---|
| PubChem CID | 171853113 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | heptadeca-2,4,11,13,15-pentaene-3,13-diol |
| SMILES | CC=CC=C(O)C=CCCCCCC=CC(O)=CC |
| InChI | InChI=1S/C17H26O2/c1-3-5-13-17(19)15-12-10-8-6-7-9-11-14-16(18)4-2/h3-5,11-15,18-19H,6-10H2,1-2H3 |
| InChIKey | CHZJPSXOXOVDSV-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|