C23H44N2O2 — CID 145234846
methanol;(2E,4Z,13Z)-18-[2-(methylamino)prop-2-enylamino]octadeca-2,4,13-trien-3-ol (PubChem CID 145234846) has the molecular formula C23H44N2O2 and a molecular weight of 380.62 g/mol. Its IUPAC name is methanol;(2E,4Z,13Z)-18-[2-(methylamino)prop-2-enylamino]octadeca-2,4,13-trien-3-ol.
| Compound Name | methanol;(2E,4Z,13Z)-18-[2-(methylamino)prop-2-enylamino]octadeca-2,4,13-trien-3-ol |
|---|---|
| PubChem CID | 145234846 |
| Molecular Formula | C23H44N2O2 |
| Molecular Weight | 380.62 g/mol |
| Exact Mass | 380.34 |
| IUPAC Name | methanol;(2E,4Z,13Z)-18-[2-(methylamino)prop-2-enylamino]octadeca-2,4,13-trien-3-ol |
| SMILES | C=C(CNCCCC/C=C\CCCCCCC/C=C\C(O)=C/C)NC.CO |
| InChI | InChI=1S/C22H40N2O.CH4O/c1-4-22(25)18-16-14-12-10-8-6-5-7-9-11-13-15-17-19-24-20-21(2)23-3;1-2/h4,9,11,16,18,23-25H,2,5-8,10,12-15,17,19-20H2,1,3H3;2H,1H3/b11-9-,18-16-,22-4+; |
| InChIKey | SEMZTWINDDGOGG-UPUCXSDXSA-N |
| XLogP | 5.39 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.62 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|