C20H42N4 — CID 88714609
N,N'-bis[(Z)-2-aminobut-2-enyl]dodecane-1,12-diamine (PubChem CID 88714609) has the molecular formula C20H42N4 and a molecular weight of 338.58 g/mol. Its IUPAC name is N,N'-bis[(Z)-2-aminobut-2-enyl]dodecane-1,12-diamine.
| Compound Name | N,N'-bis[(Z)-2-aminobut-2-enyl]dodecane-1,12-diamine |
|---|---|
| PubChem CID | 88714609 |
| Molecular Formula | C20H42N4 |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 338.34 |
| IUPAC Name | N,N'-bis[(Z)-2-aminobut-2-enyl]dodecane-1,12-diamine |
| SMILES | C/C=C(\N)CNCCCCCCCCCCCCNC/C(N)=C/C |
| InChI | InChI=1S/C20H42N4/c1-3-19(21)17-23-15-13-11-9-7-5-6-8-10-12-14-16-24-18-20(22)4-2/h3-4,23-24H,5-18,21-22H2,1-2H3/b19-3-,20-4- |
| InChIKey | ZZKWPEPAXAUFAP-WUQDJJQCSA-N |
| XLogP | 3.79 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|