C15H32N2 — CID 87082536
(E)-1-N'-dodecylprop-1-ene-1,1-diamine (PubChem CID 87082536) has the molecular formula C15H32N2 and a molecular weight of 240.43 g/mol. Its IUPAC name is (E)-1-N'-dodecylprop-1-ene-1,1-diamine.
| Compound Name | (E)-1-N'-dodecylprop-1-ene-1,1-diamine |
|---|---|
| PubChem CID | 87082536 |
| Molecular Formula | C15H32N2 |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.26 |
| IUPAC Name | (E)-1-N'-dodecylprop-1-ene-1,1-diamine |
| SMILES | C/C=C(\N)NCCCCCCCCCCCC |
| InChI | InChI=1S/C15H32N2/c1-3-5-6-7-8-9-10-11-12-13-14-17-15(16)4-2/h4,17H,3,5-14,16H2,1-2H3/b15-4+ |
| InChIKey | MAGBSHUQXUWQKJ-SYZQJQIISA-N |
| XLogP | 4.32 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|