About 2-[[(Z)-18-methylnonadec-9-enyl]amino]acetic acid;hydrate
2-[[(Z)-18-methylnonadec-9-enyl]amino]acetic acid;hydrate (PubChem CID 170842960) has the molecular formula C22H45NO3
and a molecular weight of 371.61 g/mol. Its IUPAC name is 2-[[(Z)-18-methylnonadec-9-enyl]amino]acetic acid;hydrate.
Molecular Properties
| Compound Name | 2-[[(Z)-18-methylnonadec-9-enyl]amino]acetic acid;hydrate |
| PubChem CID | 170842960 |
| Molecular Formula | C22H45NO3 |
| Molecular Weight | 371.61 g/mol |
| Exact Mass | 371.34 |
| IUPAC Name | 2-[[(Z)-18-methylnonadec-9-enyl]amino]acetic acid;hydrate |
| SMILES | CC(C)CCCCCCC/C=C\CCCCCCCCNCC(=O)O.O |
| InChI | InChI=1S/C22H43NO2.H2O/c1-21(2)18-16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-19-23-20-22(24)25;/h3-4,21,23H,5-20H2,1-2H3,(H,24,25);1H2/b4-3-; |
| InChIKey | KBOQARVVFVQLBV-LNKPDPKZSA-N |
| XLogP | 5.51 |
| TPSA | 80.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.61 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(Z)-18-methylnonadec-9-enyl]amino]acetic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(Z)-18-methylnonadec-9-enyl]amino]acetic acid;hydrate?
The IUPAC name of 2-[[(Z)-18-methylnonadec-9-enyl]amino]acetic acid;hydrate (CID 170842960) is 2-[[(Z)-18-methylnonadec-9-enyl]amino]acetic acid;hydrate.
What is the SMILES notation for 2-[[(Z)-18-methylnonadec-9-enyl]amino]acetic acid;hydrate?
The canonical SMILES for 2-[[(Z)-18-methylnonadec-9-enyl]amino]acetic acid;hydrate is CC(C)CCCCCCC/C=C\CCCCCCCCNCC(=O)O.O.
What is the InChIKey of 2-[[(Z)-18-methylnonadec-9-enyl]amino]acetic acid;hydrate?
The InChIKey is KBOQARVVFVQLBV-LNKPDPKZSA-N. The full InChI is InChI=1S/C22H43NO2.H2O/c1-21(2)18-16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-19-23-20-22(24)25;/h3-4,21,23H,5-20H2,1-2H3,(H,24,25);1H2/b4-3-;.
What are the key properties of 2-[[(Z)-18-methylnonadec-9-enyl]amino]acetic acid;hydrate?
2-[[(Z)-18-methylnonadec-9-enyl]amino]acetic acid;hydrate has a molecular weight of 371.61 g/mol, XLogP of 5.51, 19 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(Z)-18-methylnonadec-9-enyl]amino]acetic acid;hydrate is sourced from PubChem (CID 170842960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).