C20H32O3 — CID 173034724
(5Z,7Z,9E)-8-hydroxyicosa-2,5,7,9-tetraenoic acid (PubChem CID 173034724) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (5Z,7Z,9E)-8-hydroxyicosa-2,5,7,9-tetraenoic acid.
| Compound Name | (5Z,7Z,9E)-8-hydroxyicosa-2,5,7,9-tetraenoic acid |
|---|---|
| PubChem CID | 173034724 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (5Z,7Z,9E)-8-hydroxyicosa-2,5,7,9-tetraenoic acid |
| SMILES | CCCCCCCCCC/C=C/C(O)=C/C=C\CC=CC(=O)O |
| InChI | InChI=1S/C20H32O3/c1-2-3-4-5-6-7-8-9-10-13-16-19(21)17-14-11-12-15-18-20(22)23/h11,13-18,21H,2-10,12H2,1H3,(H,22,23)/b14-11-,16-13+,18-15?,19-17- |
| InChIKey | AEMFWCSPFCONTH-CNQIIOBESA-N |
| XLogP | 6.10 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|