C7H11NO2 — CID 89354713
N-[(1Z,3E)-3-hydroxypenta-1,3-dienyl]-N-methylformamide (PubChem CID 89354713) has the molecular formula C7H11NO2 and a molecular weight of 141.17 g/mol. Its IUPAC name is N-[(1Z,3E)-3-hydroxypenta-1,3-dienyl]-N-methylformamide.
| Compound Name | N-[(1Z,3E)-3-hydroxypenta-1,3-dienyl]-N-methylformamide |
|---|---|
| PubChem CID | 89354713 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | N-[(1Z,3E)-3-hydroxypenta-1,3-dienyl]-N-methylformamide |
| SMILES | C/C=C(O)\C=C/N(C)C=O |
| InChI | InChI=1S/C7H11NO2/c1-3-7(10)4-5-8(2)6-9/h3-6,10H,1-2H3/b5-4-,7-3+ |
| InChIKey | SOZQSOCJLDZKKR-SBYNAHCQSA-N |
| XLogP | 1.05 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|