C9H15NO — CID 166958378
N-[(1Z,3Z)-2-ethylpenta-1,3-dienyl]-N-methylformamide (PubChem CID 166958378) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is N-[(1Z,3Z)-2-ethylpenta-1,3-dienyl]-N-methylformamide.
| Compound Name | N-[(1Z,3Z)-2-ethylpenta-1,3-dienyl]-N-methylformamide |
|---|---|
| PubChem CID | 166958378 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | N-[(1Z,3Z)-2-ethylpenta-1,3-dienyl]-N-methylformamide |
| SMILES | C/C=C\C(=C/N(C)C=O)CC |
| InChI | InChI=1S/C9H15NO/c1-4-6-9(5-2)7-10(3)8-11/h4,6-8H,5H2,1-3H3/b6-4-,9-7- |
| InChIKey | GRZIXPVABJAXGJ-PJPBHMPJSA-N |
| XLogP | 1.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|