About ethane;2-[ethyl-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]amino]acetic acid
ethane;2-[ethyl-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]amino]acetic acid (PubChem CID 143432503) has the molecular formula C14H25NO2
and a molecular weight of 239.36 g/mol. Its IUPAC name is ethane;2-[ethyl-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]amino]acetic acid.
Molecular Properties
| Compound Name | ethane;2-[ethyl-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]amino]acetic acid |
| PubChem CID | 143432503 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | ethane;2-[ethyl-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]amino]acetic acid |
| SMILES | C=C/C=C(\C=C/C)CN(CC)CC(=O)O.CC |
| InChI | InChI=1S/C12H19NO2.C2H6/c1-4-7-11(8-5-2)9-13(6-3)10-12(14)15;1-2/h4-5,7-8H,1,6,9-10H2,2-3H3,(H,14,15);1-2H3/b8-5-,11-7+; |
| InChIKey | OOYQUZSTNIYOLG-UJCNWHNNSA-N |
| XLogP | 3.11 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-[ethyl-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-[ethyl-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]amino]acetic acid?
The IUPAC name of ethane;2-[ethyl-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]amino]acetic acid (CID 143432503) is ethane;2-[ethyl-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]amino]acetic acid.
What is the SMILES notation for ethane;2-[ethyl-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]amino]acetic acid?
The canonical SMILES for ethane;2-[ethyl-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]amino]acetic acid is C=C/C=C(\C=C/C)CN(CC)CC(=O)O.CC.
What is the InChIKey of ethane;2-[ethyl-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]amino]acetic acid?
The InChIKey is OOYQUZSTNIYOLG-UJCNWHNNSA-N. The full InChI is InChI=1S/C12H19NO2.C2H6/c1-4-7-11(8-5-2)9-13(6-3)10-12(14)15;1-2/h4-5,7-8H,1,6,9-10H2,2-3H3,(H,14,15);1-2H3/b8-5-,11-7+;.
What are the key properties of ethane;2-[ethyl-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]amino]acetic acid?
ethane;2-[ethyl-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]amino]acetic acid has a molecular weight of 239.36 g/mol, XLogP of 3.11, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-[ethyl-[(2E)-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]amino]acetic acid is sourced from PubChem (CID 143432503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).