C12H23N3 — CID 89215537
(Z,3E)-N'-ethyl-N'-[2-(methylamino)ethyl]-3-prop-2-enylidenebut-1-ene-1,4-diamine (PubChem CID 89215537) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is (Z,3E)-N'-ethyl-N'-[2-(methylamino)ethyl]-3-prop-2-enylidenebut-1-ene-1,4-diamine.
| Compound Name | (Z,3E)-N'-ethyl-N'-[2-(methylamino)ethyl]-3-prop-2-enylidenebut-1-ene-1,4-diamine |
|---|---|
| PubChem CID | 89215537 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | (Z,3E)-N'-ethyl-N'-[2-(methylamino)ethyl]-3-prop-2-enylidenebut-1-ene-1,4-diamine |
| SMILES | C=C/C=C(\C=C/N)CN(CC)CCNC |
| InChI | InChI=1S/C12H23N3/c1-4-6-12(7-8-13)11-15(5-2)10-9-14-3/h4,6-8,14H,1,5,9-11,13H2,2-3H3/b8-7-,12-6+ |
| InChIKey | RKSUTVKQKMQQFI-HRZQEMGZSA-N |
| XLogP | 1.11 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|