C10H17ClN2 — CID 142349508
N'-[(3E)-3-chlorohexa-1,3,5-trien-2-yl]-N,N'-dimethylethane-1,2-diamine (PubChem CID 142349508) has the molecular formula C10H17ClN2 and a molecular weight of 200.71 g/mol. Its IUPAC name is N'-[(3E)-3-chlorohexa-1,3,5-trien-2-yl]-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N'-[(3E)-3-chlorohexa-1,3,5-trien-2-yl]-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 142349508 |
| Molecular Formula | C10H17ClN2 |
| Molecular Weight | 200.71 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | N'-[(3E)-3-chlorohexa-1,3,5-trien-2-yl]-N,N'-dimethylethane-1,2-diamine |
| SMILES | C=C/C=C(/Cl)C(=C)N(C)CCNC |
| InChI | InChI=1S/C10H17ClN2/c1-5-6-10(11)9(2)13(4)8-7-12-3/h5-6,12H,1-2,7-8H2,3-4H3/b10-6+ |
| InChIKey | AXPIINNKIKOSDE-UXBLZVDNSA-N |
| XLogP | 1.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.71 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|