C9H20N4 — CID 134406241
(1E,3Z)-1-N'-methyl-1-N'-[2-(methylamino)ethyl]penta-1,3-diene-1,1,4-triamine (PubChem CID 134406241) has the molecular formula C9H20N4 and a molecular weight of 184.29 g/mol. Its IUPAC name is (1E,3Z)-1-N'-methyl-1-N'-[2-(methylamino)ethyl]penta-1,3-diene-1,1,4-triamine.
| Compound Name | (1E,3Z)-1-N'-methyl-1-N'-[2-(methylamino)ethyl]penta-1,3-diene-1,1,4-triamine |
|---|---|
| PubChem CID | 134406241 |
| Molecular Formula | C9H20N4 |
| Molecular Weight | 184.29 g/mol |
| Exact Mass | 184.17 |
| IUPAC Name | (1E,3Z)-1-N'-methyl-1-N'-[2-(methylamino)ethyl]penta-1,3-diene-1,1,4-triamine |
| SMILES | CNCCN(C)/C(N)=C/C=C(/C)N |
| InChI | InChI=1S/C9H20N4/c1-8(10)4-5-9(11)13(3)7-6-12-2/h4-5,12H,6-7,10-11H2,1-3H3/b8-4-,9-5+ |
| InChIKey | ALFPSYXTLXNWSN-MVTUOISNSA-N |
| XLogP | -0.20 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.29 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|