C10H20N2O — CID 129061385
(2E,4E)-5-N-(2-methoxyethyl)-5-N-methylhexa-2,4-diene-2,5-diamine (PubChem CID 129061385) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is (2E,4E)-5-N-(2-methoxyethyl)-5-N-methylhexa-2,4-diene-2,5-diamine.
| Compound Name | (2E,4E)-5-N-(2-methoxyethyl)-5-N-methylhexa-2,4-diene-2,5-diamine |
|---|---|
| PubChem CID | 129061385 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | (2E,4E)-5-N-(2-methoxyethyl)-5-N-methylhexa-2,4-diene-2,5-diamine |
| SMILES | COCCN(C)/C(C)=C/C=C(\C)N |
| InChI | InChI=1S/C10H20N2O/c1-9(11)5-6-10(2)12(3)7-8-13-4/h5-6H,7-8,11H2,1-4H3/b9-5+,10-6+ |
| InChIKey | UWRRDMQTRPMHDO-NXZHAISVSA-N |
| XLogP | 1.33 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|