About N-butyl-N-methylacetamide;ethane;N-(2-methoxyethyl)-N-methylacetamide
N-butyl-N-methylacetamide;ethane;N-(2-methoxyethyl)-N-methylacetamide (PubChem CID 142151039) has the molecular formula C15H34N2O3
and a molecular weight of 290.45 g/mol. Its IUPAC name is N-butyl-N-methylacetamide;ethane;N-(2-methoxyethyl)-N-methylacetamide.
Molecular Properties
| Compound Name | N-butyl-N-methylacetamide;ethane;N-(2-methoxyethyl)-N-methylacetamide |
| PubChem CID | 142151039 |
| Molecular Formula | C15H34N2O3 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.26 |
| IUPAC Name | N-butyl-N-methylacetamide;ethane;N-(2-methoxyethyl)-N-methylacetamide |
| SMILES | CC.CCCCN(C)C(C)=O.COCCN(C)C(C)=O |
| InChI | InChI=1S/C7H15NO.C6H13NO2.C2H6/c1-4-5-6-8(3)7(2)9;1-6(8)7(2)4-5-9-3;1-2/h4-6H2,1-3H3;4-5H2,1-3H3;1-2H3 |
| InChIKey | QKBSJJLMGDZBKH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-butyl-N-methylacetamide;ethane;N-(2-methoxyethyl)-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N-methylacetamide;ethane;N-(2-methoxyethyl)-N-methylacetamide?
The IUPAC name of N-butyl-N-methylacetamide;ethane;N-(2-methoxyethyl)-N-methylacetamide (CID 142151039) is N-butyl-N-methylacetamide;ethane;N-(2-methoxyethyl)-N-methylacetamide.
What is the SMILES notation for N-butyl-N-methylacetamide;ethane;N-(2-methoxyethyl)-N-methylacetamide?
The canonical SMILES for N-butyl-N-methylacetamide;ethane;N-(2-methoxyethyl)-N-methylacetamide is CC.CCCCN(C)C(C)=O.COCCN(C)C(C)=O.
What is the InChIKey of N-butyl-N-methylacetamide;ethane;N-(2-methoxyethyl)-N-methylacetamide?
The InChIKey is QKBSJJLMGDZBKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO.C6H13NO2.C2H6/c1-4-5-6-8(3)7(2)9;1-6(8)7(2)4-5-9-3;1-2/h4-6H2,1-3H3;4-5H2,1-3H3;1-2H3.
What are the key properties of N-butyl-N-methylacetamide;ethane;N-(2-methoxyethyl)-N-methylacetamide?
N-butyl-N-methylacetamide;ethane;N-(2-methoxyethyl)-N-methylacetamide has a molecular weight of 290.45 g/mol, XLogP of 2.40, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N-methylacetamide;ethane;N-(2-methoxyethyl)-N-methylacetamide is sourced from PubChem (CID 142151039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).