About N'-butyl-N-(3-methoxypropyl)-N'-methylpropanediamide
N'-butyl-N-(3-methoxypropyl)-N'-methylpropanediamide (PubChem CID 108943305) has the molecular formula C12H24N2O3
and a molecular weight of 244.33 g/mol. Its IUPAC name is N'-butyl-N-(3-methoxypropyl)-N'-methylpropanediamide.
Molecular Properties
| Compound Name | N'-butyl-N-(3-methoxypropyl)-N'-methylpropanediamide |
| PubChem CID | 108943305 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | N'-butyl-N-(3-methoxypropyl)-N'-methylpropanediamide |
| SMILES | CCCCN(C)C(=O)CC(=O)NCCCOC |
| InChI | InChI=1S/C12H24N2O3/c1-4-5-8-14(2)12(16)10-11(15)13-7-6-9-17-3/h4-10H2,1-3H3,(H,13,15) |
| InChIKey | RRSUEPKPDNZPKJ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N'-butyl-N-(3-methoxypropyl)-N'-methylpropanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-butyl-N-(3-methoxypropyl)-N'-methylpropanediamide?
The IUPAC name of N'-butyl-N-(3-methoxypropyl)-N'-methylpropanediamide (CID 108943305) is N'-butyl-N-(3-methoxypropyl)-N'-methylpropanediamide.
What is the SMILES notation for N'-butyl-N-(3-methoxypropyl)-N'-methylpropanediamide?
The canonical SMILES for N'-butyl-N-(3-methoxypropyl)-N'-methylpropanediamide is CCCCN(C)C(=O)CC(=O)NCCCOC.
What is the InChIKey of N'-butyl-N-(3-methoxypropyl)-N'-methylpropanediamide?
The InChIKey is RRSUEPKPDNZPKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O3/c1-4-5-8-14(2)12(16)10-11(15)13-7-6-9-17-3/h4-10H2,1-3H3,(H,13,15).
What are the key properties of N'-butyl-N-(3-methoxypropyl)-N'-methylpropanediamide?
N'-butyl-N-(3-methoxypropyl)-N'-methylpropanediamide has a molecular weight of 244.33 g/mol, XLogP of 0.79, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-butyl-N-(3-methoxypropyl)-N'-methylpropanediamide is sourced from PubChem (CID 108943305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).