C12H24N2O2 — CID 108941430
N,N'-dibutyl-N'-methylpropanediamide (PubChem CID 108941430) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is N,N'-dibutyl-N'-methylpropanediamide.
| Compound Name | N,N'-dibutyl-N'-methylpropanediamide |
|---|---|
| PubChem CID | 108941430 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | N,N'-dibutyl-N'-methylpropanediamide |
| SMILES | CCCCNC(=O)CC(=O)N(C)CCCC |
| InChI | InChI=1S/C12H24N2O2/c1-4-6-8-13-11(15)10-12(16)14(3)9-7-5-2/h4-10H2,1-3H3,(H,13,15) |
| InChIKey | MYVQKPRQFKPYKD-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|