About N-butan-2-yl-N'-butyl-N'-methylpropanediamide
N-butan-2-yl-N'-butyl-N'-methylpropanediamide (PubChem CID 108941812) has the molecular formula C12H24N2O2
and a molecular weight of 228.34 g/mol. Its IUPAC name is N-butan-2-yl-N'-butyl-N'-methylpropanediamide.
Molecular Properties
| Compound Name | N-butan-2-yl-N'-butyl-N'-methylpropanediamide |
| PubChem CID | 108941812 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | N-butan-2-yl-N'-butyl-N'-methylpropanediamide |
| SMILES | CCCCN(C)C(=O)CC(=O)NC(C)CC |
| InChI | InChI=1S/C12H24N2O2/c1-5-7-8-14(4)12(16)9-11(15)13-10(3)6-2/h10H,5-9H2,1-4H3,(H,13,15) |
| InChIKey | MTIKFVSUUMBRNG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N-butan-2-yl-N'-butyl-N'-methylpropanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-N'-butyl-N'-methylpropanediamide?
The IUPAC name of N-butan-2-yl-N'-butyl-N'-methylpropanediamide (CID 108941812) is N-butan-2-yl-N'-butyl-N'-methylpropanediamide.
What is the SMILES notation for N-butan-2-yl-N'-butyl-N'-methylpropanediamide?
The canonical SMILES for N-butan-2-yl-N'-butyl-N'-methylpropanediamide is CCCCN(C)C(=O)CC(=O)NC(C)CC.
What is the InChIKey of N-butan-2-yl-N'-butyl-N'-methylpropanediamide?
The InChIKey is MTIKFVSUUMBRNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O2/c1-5-7-8-14(4)12(16)9-11(15)13-10(3)6-2/h10H,5-9H2,1-4H3,(H,13,15).
What are the key properties of N-butan-2-yl-N'-butyl-N'-methylpropanediamide?
N-butan-2-yl-N'-butyl-N'-methylpropanediamide has a molecular weight of 228.34 g/mol, XLogP of 1.55, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-N'-butyl-N'-methylpropanediamide is sourced from PubChem (CID 108941812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).