About N-butyl-N-methylacetamide;ethane;methyl N-methyl-N-(4-methylpentyl)carbamate
N-butyl-N-methylacetamide;ethane;methyl N-methyl-N-(4-methylpentyl)carbamate (PubChem CID 168941081) has the molecular formula C20H46N2O3
and a molecular weight of 362.60 g/mol. Its IUPAC name is N-butyl-N-methylacetamide;ethane;methyl N-methyl-N-(4-methylpentyl)carbamate.
Molecular Properties
| Compound Name | N-butyl-N-methylacetamide;ethane;methyl N-methyl-N-(4-methylpentyl)carbamate |
| PubChem CID | 168941081 |
| Molecular Formula | C20H46N2O3 |
| Molecular Weight | 362.60 g/mol |
| Exact Mass | 362.35 |
| IUPAC Name | N-butyl-N-methylacetamide;ethane;methyl N-methyl-N-(4-methylpentyl)carbamate |
| SMILES | CC.CC.CCCCN(C)C(C)=O.COC(=O)N(C)CCCC(C)C |
| InChI | InChI=1S/C9H19NO2.C7H15NO.2C2H6/c1-8(2)6-5-7-10(3)9(11)12-4;1-4-5-6-8(3)7(2)9;2*1-2/h8H,5-7H2,1-4H3;4-6H2,1-3H3;2*1-2H3 |
| InChIKey | JADUVVDJOQYXJP-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.60 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-butyl-N-methylacetamide;ethane;methyl N-methyl-N-(4-methylpentyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N-methylacetamide;ethane;methyl N-methyl-N-(4-methylpentyl)carbamate?
The IUPAC name of N-butyl-N-methylacetamide;ethane;methyl N-methyl-N-(4-methylpentyl)carbamate (CID 168941081) is N-butyl-N-methylacetamide;ethane;methyl N-methyl-N-(4-methylpentyl)carbamate.
What is the SMILES notation for N-butyl-N-methylacetamide;ethane;methyl N-methyl-N-(4-methylpentyl)carbamate?
The canonical SMILES for N-butyl-N-methylacetamide;ethane;methyl N-methyl-N-(4-methylpentyl)carbamate is CC.CC.CCCCN(C)C(C)=O.COC(=O)N(C)CCCC(C)C.
What is the InChIKey of N-butyl-N-methylacetamide;ethane;methyl N-methyl-N-(4-methylpentyl)carbamate?
The InChIKey is JADUVVDJOQYXJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO2.C7H15NO.2C2H6/c1-8(2)6-5-7-10(3)9(11)12-4;1-4-5-6-8(3)7(2)9;2*1-2/h8H,5-7H2,1-4H3;4-6H2,1-3H3;2*1-2H3.
What are the key properties of N-butyl-N-methylacetamide;ethane;methyl N-methyl-N-(4-methylpentyl)carbamate?
N-butyl-N-methylacetamide;ethane;methyl N-methyl-N-(4-methylpentyl)carbamate has a molecular weight of 362.60 g/mol, XLogP of 5.44, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N-methylacetamide;ethane;methyl N-methyl-N-(4-methylpentyl)carbamate is sourced from PubChem (CID 168941081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).