C12H27N3O4 — CID 130458447
(Z)-1-[amino-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]amino]prop-1-en-2-amine (PubChem CID 130458447) has the molecular formula C12H27N3O4 and a molecular weight of 277.36 g/mol. Its IUPAC name is (Z)-1-[amino-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]amino]prop-1-en-2-amine.
| Compound Name | (Z)-1-[amino-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]amino]prop-1-en-2-amine |
|---|---|
| PubChem CID | 130458447 |
| Molecular Formula | C12H27N3O4 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | (Z)-1-[amino-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethyl]amino]prop-1-en-2-amine |
| SMILES | COCCOCCOCCOCCN(N)/C=C(/C)N |
| InChI | InChI=1S/C12H27N3O4/c1-12(13)11-15(14)3-4-17-7-8-19-10-9-18-6-5-16-2/h11H,3-10,13-14H2,1-2H3/b12-11- |
| InChIKey | IBTPUYWXVJXLOX-QXMHVHEDSA-N |
| XLogP | -0.32 |
| TPSA | 92.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|