C16H26N4O5 — CID 178001475
2-[(Z)-1-amino-2-[amino-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]amino]ethenyl]-5-(methylamino)cyclohexa-2,5-diene-1,4-dione (PubChem CID 178001475) has the molecular formula C16H26N4O5 and a molecular weight of 354.41 g/mol. Its IUPAC name is 2-[(Z)-1-amino-2-[amino-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]amino]ethenyl]-5-(methylamino)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[(Z)-1-amino-2-[amino-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]amino]ethenyl]-5-(methylamino)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 178001475 |
| Molecular Formula | C16H26N4O5 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 2-[(Z)-1-amino-2-[amino-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]amino]ethenyl]-5-(methylamino)cyclohexa-2,5-diene-1,4-dione |
| SMILES | CNC1=CC(=O)C(/C(N)=C/N(N)CCOCCOCCOC)=CC1=O |
| InChI | InChI=1S/C16H26N4O5/c1-19-14-10-15(21)12(9-16(14)22)13(17)11-20(18)3-4-24-7-8-25-6-5-23-2/h9-11,19H,3-8,17-18H2,1-2H3/b13-11- |
| InChIKey | QASUKTGPOBNUAF-QBFSEMIESA-N |
| XLogP | -1.18 |
| TPSA | 129.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|