C20H28F5N3O7 — CID 176973015
(2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[2-[2-[amino-[(Z)-2-amino-3-hydroxyprop-1-enyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (PubChem CID 176973015) has the molecular formula C20H28F5N3O7 and a molecular weight of 517.45 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[2-[2-[amino-[(Z)-2-amino-3-hydroxyprop-1-enyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[2-[2-[amino-[(Z)-2-amino-3-hydroxyprop-1-enyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 176973015 |
| Molecular Formula | C20H28F5N3O7 |
| Molecular Weight | 517.45 g/mol |
| Exact Mass | 517.18 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 3-[2-[2-[2-[2-[amino-[(Z)-2-amino-3-hydroxyprop-1-enyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| SMILES | N/C(=C\N(N)CCOCCOCCOCCOCCC(=O)Oc1c(F)c(F)c(F)c(F)c1F)CO |
| InChI | InChI=1S/C20H28F5N3O7/c21-15-16(22)18(24)20(19(25)17(15)23)35-14(30)1-3-31-5-7-33-9-10-34-8-6-32-4-2-28(27)11-13(26)12-29/h11,29H,1-10,12,26-27H2/b13-11- |
| InChIKey | NDAGPGNFNUAZOT-QBFSEMIESA-N |
| XLogP | 0.71 |
| TPSA | 138.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.45 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|