C17H19F5O5 — CID 140621862
(2,3,4,5,6-pentafluorophenyl) 3-[2-(4-methyl-3-oxopentoxy)ethoxy]propanoate (PubChem CID 140621862) has the molecular formula C17H19F5O5 and a molecular weight of 398.32 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 3-[2-(4-methyl-3-oxopentoxy)ethoxy]propanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 3-[2-(4-methyl-3-oxopentoxy)ethoxy]propanoate |
|---|---|
| PubChem CID | 140621862 |
| Molecular Formula | C17H19F5O5 |
| Molecular Weight | 398.32 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 3-[2-(4-methyl-3-oxopentoxy)ethoxy]propanoate |
| SMILES | CC(C)C(=O)CCOCCOCCC(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C17H19F5O5/c1-9(2)10(23)3-5-25-7-8-26-6-4-11(24)27-17-15(21)13(19)12(18)14(20)16(17)22/h9H,3-8H2,1-2H3 |
| InChIKey | XQELCICCXPRIOU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|