C12H15F4O7S+ — CID 163402826
[dihydroxy-[2,3,5,6-tetrafluoro-4-[3-(2-methoxyethoxy)propanoyloxy]phenyl]-λ4-sulfanyl]oxidanium (PubChem CID 163402826) has the molecular formula C12H15F4O7S+ and a molecular weight of 379.30 g/mol. Its IUPAC name is [dihydroxy-[2,3,5,6-tetrafluoro-4-[3-(2-methoxyethoxy)propanoyloxy]phenyl]-λ4-sulfanyl]oxidanium.
| Compound Name | [dihydroxy-[2,3,5,6-tetrafluoro-4-[3-(2-methoxyethoxy)propanoyloxy]phenyl]-λ4-sulfanyl]oxidanium |
|---|---|
| PubChem CID | 163402826 |
| Molecular Formula | C12H15F4O7S+ |
| Molecular Weight | 379.30 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | [dihydroxy-[2,3,5,6-tetrafluoro-4-[3-(2-methoxyethoxy)propanoyloxy]phenyl]-λ4-sulfanyl]oxidanium |
| SMILES | COCCOCCC(=O)Oc1c(F)c(F)c(S(O)(O)[OH2+])c(F)c1F |
| InChI | InChI=1S/C12H14F4O7S/c1-21-4-5-22-3-2-6(17)23-11-7(13)9(15)12(24(18,19)20)10(16)8(11)14/h18-20H,2-5H2,1H3/p+1 |
| InChIKey | DUECKTFGHYFRSF-UHFFFAOYSA-O |
| XLogP | 1.95 |
| TPSA | 108.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|