C12H26N2O5 — CID 104565052
3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2-methyl-2-(methylamino)propanamide (PubChem CID 104565052) has the molecular formula C12H26N2O5 and a molecular weight of 278.35 g/mol. Its IUPAC name is 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2-methyl-2-(methylamino)propanamide.
| Compound Name | 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2-methyl-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 104565052 |
| Molecular Formula | C12H26N2O5 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 3-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2-methyl-2-(methylamino)propanamide |
| SMILES | CNC(C)(COCCOCCOCCOC)C(N)=O |
| InChI | InChI=1S/C12H26N2O5/c1-12(14-2,11(13)15)10-19-9-8-18-7-6-17-5-4-16-3/h14H,4-10H2,1-3H3,(H2,13,15) |
| InChIKey | GBCSVRMHFCHFIX-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|